DB00973 Ezetimibe
InChI Key: OLNTVTPDXPETLC-XPWALMASSA-N
SMILES: [H][C@]1(CC[C@H](O)C2=CC=C(F)C=C2)C(=O)N(C2=CC=C(F)C=C2)[C@]1([H])C1=CC=C(O)C=C1
Small molecule PDB accession : H56
Drug action: other
List of PDB structures and/or AlphaFold models with target protein P15144
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P15144 | Download | Predicted | P15144_nD2 P15144_nD3 P15144_nD5 P15144_nD4 | Baculovirus p35 protein-related Zincin-like Repetitive alpha hairpins Immunoglobulin-like beta-sandwich | |
| 4FYQ | Predicted | e4fyqA1 e4fyqA4 e4fyqA2 e4fyqA3 | |||
| 4FYR | Predicted | e4fyrA5 e4fyrA6 e4fyrA2 e4fyrA4 | |||
| 4FYS | Predicted | e4fysA3 e4fysA6 e4fysA2 e4fysA4 | |||
| 4FYT | Predicted | e4fytA5 e4fytA6 e4fytA2 e4fytA4 | |||
| 5LHD | Predicted | e5lhdA2 e5lhdB3 e5lhdC1 e5lhdD4 e5lhdA4 e5lhdB4 e5lhdC4 e5lhdD2 e5lhdA3 e5lhdB1 e5lhdC3 e5lhdD3 e5lhdA1 e5lhdB2 e5lhdC2 e5lhdD1 | |||
| 6ATK | Predicted | e6atkA2 e6atkB4 e6atkC3 e6atkA3 e6atkB1 e6atkC4 e6atkA4 e6atkB2 e6atkC2 e6atkA1 e6atkB3 e6atkC1 | |||
| 6U7E | Predicted | e6u7eA1 e6u7eB4 e6u7eA4 e6u7eB1 e6u7eA2 e6u7eB2 e6u7eA3 e6u7eB3 | |||
| 6U7F | Predicted | e6u7fA1 e6u7fB2 e6u7fA2 e6u7fB4 e6u7fA3 e6u7fB1 e6u7fA4 e6u7fB3 | |||
| 6U7G | Predicted | e6u7gA2 e6u7gB3 e6u7gA1 e6u7gB1 e6u7gA3 e6u7gB4 e6u7gA4 e6u7gB2 |