DB06977 (2S)-1-{[5-(1H-Indazol-5-yl)-3-pyridinyl]oxy}-3-(7aH-indol-3-yl)-2-propanamine
InChI Key: CAASENZOSQYNPX-HSTJUUNISA-N
SMILES: [H][C@@](N)(COC1=CN=CC(=C1)C1=CC2=CNN=C2C=C1)CC1=C2C=CC=CC2([H])N=C1
Small molecule PDB accession : 2PY
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P17612
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P17612 | Download | Predicted | P17612_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
2GU8 | Predicted | e2gu8A1 | |||
3AGL | Predicted | e3aglB1 e3aglA1 | |||
3AGM | Predicted | e3agmA1 | |||
3AMA | Predicted | e3amaA1 | |||
3AMB | Predicted | e3ambA1 | |||
3L9L | Predicted | e3l9lA1 e3l9lB1 | |||
3L9M | Predicted | e3l9mA1 e3l9mB1 | |||
3L9N | Predicted | e3l9nA1 | |||
3MVJ | Predicted | e3mvjA1 e3mvjB1 e3mvjE1 | |||
3NX8 | Predicted | e3nx8A1 | |||
3OOG | Predicted | e3oogA1 | |||
3OVV | Predicted | e3ovvA1 | |||
3OWP | Predicted | e3owpA1 | |||
3OXT | Predicted | e3oxtA1 | |||
3P0M | Predicted | e3p0mA1 | |||
3POO | Predicted | e3pooA1 | |||
3VQH | Predicted | e3vqhA2 | |||
4AE6 | Predicted | e4ae6B2 e4ae6A2 | |||
4AE9 | Predicted | e4ae9A2 e4ae9B2 | |||
4UJ1 | Predicted | e4uj1A1 | |||
4UJ2 | Predicted | e4uj2A1 | |||
4UJA | Predicted | e4ujaA1 | |||
4UJB | Predicted | e4ujbA1 | |||
4WB5 | Predicted | e4wb5A1 | |||
4WB6 | Predicted | e4wb6A1 e4wb6B1 | |||
4WB7 | Predicted | e4wb7A1 | |||
4WB8 | Predicted | e4wb8A1 | |||
5BX6 | Predicted | e5bx6A1 | |||
5BX7 | Predicted | e5bx7A1 | |||
5IZF | Predicted | e5izfA1 | |||
5IZJ | Predicted | e5izjA1 e5izjB1 | |||
5J5X | Predicted | e5j5xA1 | |||
5N23 | Predicted | e5n23A1 | |||
5UZK | Predicted | e5uzkA1 | |||
6BYR | Predicted | e6byrA1 e6byrC1 | |||
6BYS | Predicted | e6bysA1 e6bysC1 e6bysE1 e6bysG1 | |||
6C0U | Predicted | e6c0uA1 | |||
6FRX | Predicted | e6frxA1 | |||
6NO7 | Predicted | e6no7C1 e6no7A1 e6no7E1 e6no7G1 |