DB08846 Ellagic acid
InChI Key: AFSDNFLWKVMVRB-UHFFFAOYSA-N
SMILES: OC1=C(O)C2=C3C(=C1)C(=O)OC1=C3C(=CC(O)=C1O)C(=O)O2
Small molecule PDB accession : REF
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P17612
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P17612 | Download | Predicted | P17612_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 2GU8 | Predicted | e2gu8A1 | |||
| 3AGL | Predicted | e3aglB1 e3aglA1 | |||
| 3AGM | Predicted | e3agmA1 | |||
| 3AMA | Predicted | e3amaA1 | |||
| 3AMB | Predicted | e3ambA1 | |||
| 3L9L | Predicted | e3l9lA1 e3l9lB1 | |||
| 3L9M | Predicted | e3l9mA1 e3l9mB1 | |||
| 3L9N | Predicted | e3l9nA1 | |||
| 3MVJ | Predicted | e3mvjA1 e3mvjB1 e3mvjE1 | |||
| 3NX8 | Predicted | e3nx8A1 | |||
| 3OOG | Predicted | e3oogA1 | |||
| 3OVV | Predicted | e3ovvA1 | |||
| 3OWP | Predicted | e3owpA1 | |||
| 3OXT | Predicted | e3oxtA1 | |||
| 3P0M | Predicted | e3p0mA1 | |||
| 3POO | Predicted | e3pooA1 | |||
| 3VQH | Predicted | e3vqhA2 | |||
| 4AE6 | Predicted | e4ae6B2 e4ae6A2 | |||
| 4AE9 | Predicted | e4ae9A2 e4ae9B2 | |||
| 4UJ1 | Predicted | e4uj1A1 | |||
| 4UJ2 | Predicted | e4uj2A1 | |||
| 4UJA | Predicted | e4ujaA1 | |||
| 4UJB | Predicted | e4ujbA1 | |||
| 4WB5 | Predicted | e4wb5A1 | |||
| 4WB6 | Predicted | e4wb6A1 e4wb6B1 | |||
| 4WB7 | Predicted | e4wb7A1 | |||
| 4WB8 | Predicted | e4wb8A1 | |||
| 5BX6 | Predicted | e5bx6A1 | |||
| 5BX7 | Predicted | e5bx7A1 | |||
| 5IZF | Predicted | e5izfA1 | |||
| 5IZJ | Predicted | e5izjA1 e5izjB1 | |||
| 5J5X | Predicted | e5j5xA1 | |||
| 5N23 | Predicted | e5n23A1 | |||
| 5UZK | Predicted | e5uzkA1 | |||
| 6BYR | Predicted | e6byrA1 e6byrC1 | |||
| 6BYS | Predicted | e6bysA1 e6bysC1 e6bysE1 e6bysG1 | |||
| 6C0U | Predicted | e6c0uA1 | |||
| 6FRX | Predicted | e6frxA1 | |||
| 6NO7 | Predicted | e6no7C1 e6no7A1 e6no7E1 e6no7G1 |