DB00118 Ademetionine
InChI Key: MEFKEPWMEQBLKI-AIRLBKTGSA-N
SMILES: C[S+](CC[C@H](N)C([O-])=O)C[C@H]1O[C@H]([C@H](O)[C@@H]1O)N1C=NC2=C1N=CN=C2N
Small molecule PDB accession : n/a
Drug action: cofactor
List of PDB structures and/or AlphaFold models with target protein P17707
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P17707 | Download | Predicted | P17707_nD1 | TBP-like | |
1I72 | Predicted | e1i72.1 | |||
1I79 | Predicted | e1i79.1 | |||
1I7B | Predicted | e1i7b.1 | |||
1I7C | Predicted | e1i7c.1 | |||
1I7M | Predicted | e1i7m.1 e1i7m.2 | |||
1JEN | Predicted | e1jen.1 e1jen.2 | |||
1JL0 | Predicted | e1jl0A1 e1jl0B1 | |||
1MSV | Predicted | e1msvA1 e1msvB1 | |||
3DZ2 | Predicted | e3dz2.1 | |||
3DZ3 | Predicted | e3dz3.1 | |||
3DZ4 | Predicted | e3dz4.1 | |||
3DZ5 | Predicted | e3dz5.1 | |||
3DZ6 | Predicted | e3dz6.1 | |||
3DZ7 | Predicted | e3dz7.1 | |||
3EP3 | Predicted | e3ep3.1 | |||
3EP4 | Predicted | e3ep4.1 | |||
3EP5 | Predicted | e3ep5.1 | |||
3EP6 | Predicted | e3ep6.1 | |||
3EP7 | Predicted | e3ep7.1 | |||
3EP8 | Predicted | e3ep8.1 | |||
3EP9 | Predicted | e3ep9.1 | |||
3EPA | Predicted | e3epa.1 | |||
3EPB | Predicted | e3epb.1 | |||
3H0V | Predicted | e3h0v.1 | |||
3H0W | Predicted | e3h0w.1 |