DB12095 Telotristat ethyl
InChI Key: MDSQOJYHHZBZKA-GBXCKJPGSA-N
SMILES: CCOC(=O)[C@@H](N)CC1=CC=C(C=C1)C1=NC(N)=NC(O[C@H](C2=CC=C(Cl)C=C2N2C=CC(C)=N2)C(F)(F)F)=C1
Small molecule PDB accession : n/a
Drug action: antagonist
List of PDB structures and/or AlphaFold models with target protein P17752
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P17752 | Download | Predicted | P17752_nD2 | Aromatic aminoacid monoxygenases, catalytic and oligomerization domains | |
| 1MLW | Predicted | e1mlwA1 | |||
| 3HF6 | Predicted | e3hf6A1 | |||
| 3HF8 | Predicted | e3hf8A1 | |||
| 3HFB | Predicted | e3hfbA1 | |||
| 5J6D | Predicted | e5j6dA1 e5j6dB1 | |||
| 5L01 | Predicted | e5l01A1 | |||
| 5TPG | Predicted | e5tpgA1 |