DB04660 Choline alfoscerate
InChI Key: SUHOQUVVVLNYQR-MRVPVSSYSA-N
SMILES: [H][C@@](O)(CO)COP([O-])(=O)OCC[N+](C)(C)C
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P17900
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P17900 | Download | Predicted | P17900_nD1 | Immunoglobulin-like beta-sandwich | |
| 1G13 | Predicted | e1g13A1 e1g13C1 e1g13B1 | |||
| 1PU5 | Predicted | e1pu5A1 e1pu5C1 e1pu5B1 | |||
| 1PUB | Predicted | e1pubA1 | |||
| 1TJJ | Predicted | e1tjjC1 e1tjjA1 e1tjjB1 | |||
| 2AF9 | Predicted | e2af9A1 | |||
| 2AG2 | Predicted | e2ag2A1 e2ag2C1 e2ag2B1 | |||
| 2AG4 | Predicted | e2ag4A1 e2ag4B1 | |||
| 2AG9 | Predicted | e2ag9A1 e2ag9B1 |