DB11638 Artenimol
InChI Key: BJDCWCLMFKKGEE-HVDUHBCDSA-N
SMILES: [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4
Small molecule PDB accession : n/a
Drug action: ligand
List of PDB structures and/or AlphaFold models with target protein P18669
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P18669 | Download | Predicted | P18669_nD1 | Phosphoglycerate mutase-like | |
| 1YFK | Predicted | e1yfkA1 e1yfkB1 | |||
| 1YJX | Predicted | e1yjxA1 e1yjxB1 e1yjxC1 e1yjxD1 e1yjxE1 e1yjxF1 e1yjxG1 e1yjxH1 e1yjxI1 e1yjxJ1 e1yjxK1 e1yjxL1 | |||
| 4GPI | Predicted | e4gpiB1 e4gpiC1 | |||
| 4GPZ | Predicted | e4gpzA1 e4gpzB1 | |||
| 5Y2I | Predicted | e5y2iB1 e5y2iC1 | |||
| 5Y2U | Predicted | e5y2uB1 e5y2uC1 | |||
| 5Y35 | Predicted | e5y35B1 e5y35C1 | |||
| 5Y64 | Predicted | e5y64B1 e5y64C1 | |||
| 5Y65 | Predicted | e5y65C1 e5y65B1 | |||
| 5ZRM | Predicted | e5zrmC1 e5zrmB1 | |||
| 5ZS8 | Predicted | e5zs8C1 e5zs8B1 | |||
| 6ISN | Predicted | e6isnC1 e6isnB1 |