DB02342 2-Methoxyestradiol
InChI Key: CQOQDQWUFQDJMK-SSTWWWIQSA-N
SMILES: [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C(OC)=C3
Small molecule PDB accession : ESM
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P21964
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P21964 | Download | Predicted | P21964_nD1 | Rossmann-like | |
| 3A7E | Predicted | e3a7eA1 | |||
| 3BWM | Predicted | e3bwmA1 | |||
| 3BWY | Predicted | e3bwyA1 | |||
| 4PYI | Predicted | e4pyiA1 | |||
| 4PYJ | Predicted | e4pyjA1 | |||
| 4PYK | Predicted | e4pykA1 | |||
| 4XUC | Predicted | e4xucA1 | |||
| 4XUD | Predicted | e4xudA1 | |||
| 4XUE | Predicted | e4xueB1 e4xueA1 | |||
| 5LSA | Predicted | e5lsaA1 | |||
| 6I3C | Predicted | e6i3cA1 | |||
| 6I3D | Predicted | e6i3dB1 e6i3dA1 |