DB02236 Glycinamide Ribonucleotide
InChI Key: OBQMLSFOUZUIOB-HJZCUYRDSA-N
SMILES: NCC(=O)NC1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P22102
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P22102 | Download | Predicted | P22102_nD1 P22102_nD6 P22102_nD5 P22102_nD4 P22102_nD2 | Rossmann-like Formyltransferase Alpha-beta plaits Bacillus chorismate mutase-like Protein kinase/SAICAR synthase/ATP-grasp | |
| 1MEJ | Predicted | e1mejB1 e1mejC1 e1mejA1 | |||
| 1MEN | Predicted | e1menC1 e1menA1 e1menB1 | |||
| 1MEO | Predicted | e1meoA1 | |||
| 1NJS | Predicted | e1njsA1 e1njsB1 | |||
| 1RBM | Predicted | e1rbmB1 e1rbmA1 | |||
| 1RBQ | Predicted | e1rbqC1 e1rbqA1 e1rbqB1 e1rbqD1 | |||
| 1RBY | Predicted | e1rbyA1 e1rbyC1 e1rbyB1 e1rbyD1 | |||
| 1RBZ | Predicted | e1rbzA1 e1rbzB1 | |||
| 1RC0 | Predicted | e1rc0A1 e1rc0B1 | |||
| 1RC1 | Predicted | e1rc1A1 e1rc1B1 | |||
| 1ZLX | Predicted | e1zlxA1 | |||
| 1ZLY | Predicted | e1zlyA1 | |||
| 2QK4 | Predicted | e2qk4A1 e2qk4B1 e2qk4A3 e2qk4B2 e2qk4A2 e2qk4B3 | |||
| 2V9Y | Predicted | e2v9yA3 e2v9yB3 e2v9yA4 e2v9yB4 | |||
| 4EW1 | Predicted | e4ew1A1 | |||
| 4EW2 | Predicted | e4ew2A1 | |||
| 4EW3 | Predicted | e4ew3A1 | |||
| 4ZYT | Predicted | e4zytA1 | |||
| 4ZYU | Predicted | e4zyuA1 | |||
| 4ZYV | Predicted | e4zyvA1 | |||
| 4ZYW | Predicted | e4zywA1 | |||
| 4ZYX | Predicted | e4zyxA1 | |||
| 4ZYY | Predicted | e4zyyA1 | |||
| 4ZYZ | Predicted | e4zyzA1 | |||
| 4ZZ0 | Predicted | e4zz0A1 | |||
| 4ZZ1 | Predicted | e4zz1A1 | |||
| 4ZZ2 | Predicted | e4zz2A1 | |||
| 4ZZ3 | Predicted | e4zz3A1 | |||
| 5J9F | Predicted | e5j9fA1 |