DB12147 Erdafitinib
InChI Key: OLAHOMJCDNXHFI-UHFFFAOYSA-N
SMILES: COC1=CC(=CC(OC)=C1)N(CCNC(C)C)C1=CC=C2N=CC(=NC2=C1)C1=CN(C)N=C1
Small molecule PDB accession : 5SF
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P22455
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P22455 | Download | Predicted | P22455_nD3 P22455_nD2 P22455_nD1 | Protein kinase/SAICAR synthase/ATP-grasp Immunoglobulin-like beta-sandwich Immunoglobulin-like beta-sandwich | |
4QQ5 | Predicted | e4qq5A1 | |||
4QQC | Predicted | e4qqcA1 | |||
4QQJ | Predicted | e4qqjA1 | |||
4QQT | Predicted | e4qqtA1 | |||
4QRC | Predicted | e4qrcA1 | |||
4R6V | Predicted | e4r6vA1 | |||
4TYE | Predicted | e4tyeA1 | |||
4TYG | Predicted | e4tygA1 | |||
4TYI | Predicted | e4tyiA1 | |||
4TYJ | Predicted | e4tyjA1 | |||
4UXQ | Predicted | e4uxqA1 | |||
4XCU | Predicted | e4xcuA1 | |||
5JKG | Predicted | e5jkgA1 | |||
5NUD | Predicted | e5nudA1 e5nudB1 | |||
5NWZ | Predicted | e5nwzA1 e5nwzB1 | |||
5XFF | Predicted | e5xffA1 | |||
5XFJ | Predicted | e5xfjA1 | |||
6IUO | Predicted | e6iuoA1 | |||
6IUP | Predicted | e6iupA1 | |||
6J6Y | Predicted | e6j6yA1 e6j6yD1 | |||
6JPJ | Predicted | e6jpjA1 | |||
6NVG | Predicted | e6nvgA1 | |||
6NVH | Predicted | e6nvhA1 | |||
6NVI | Predicted | e6nviA1 | |||
6NVJ | Predicted | e6nvjA1 | |||
6NVK | Predicted | e6nvkA1 |