DB15149 Futibatinib
InChI Key: KEIPNCCJPRMIAX-HNNXBMFYSA-N
SMILES: COC1=CC(=CC(OC)=C1)C#CC1=NN([C@H]2CCN(C2)C(=O)C=C)C2=C1C(N)=NC=N2
Small molecule PDB accession : TZ0
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P22455
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P22455 | Download | Predicted | P22455_nD3 P22455_nD2 P22455_nD1 | Protein kinase/SAICAR synthase/ATP-grasp Immunoglobulin-like beta-sandwich Immunoglobulin-like beta-sandwich | |
| 4QQ5 | Predicted | e4qq5A1 | |||
| 4QQC | Predicted | e4qqcA1 | |||
| 4QQJ | Predicted | e4qqjA1 | |||
| 4QQT | Predicted | e4qqtA1 | |||
| 4QRC | Predicted | e4qrcA1 | |||
| 4R6V | Predicted | e4r6vA1 | |||
| 4TYE | Predicted | e4tyeA1 | |||
| 4TYG | Predicted | e4tygA1 | |||
| 4TYI | Predicted | e4tyiA1 | |||
| 4TYJ | Predicted | e4tyjA1 | |||
| 4UXQ | Predicted | e4uxqA1 | |||
| 4XCU | Predicted | e4xcuA1 | |||
| 5JKG | Predicted | e5jkgA1 | |||
| 5NUD | Predicted | e5nudA1 e5nudB1 | |||
| 5NWZ | Predicted | e5nwzA1 e5nwzB1 | |||
| 5XFF | Predicted | e5xffA1 | |||
| 5XFJ | Predicted | e5xfjA1 | |||
| 6IUO | Predicted | e6iuoA1 | |||
| 6IUP | Predicted | e6iupA1 | |||
| 6J6Y | Predicted | e6j6yA1 e6j6yD1 | |||
| 6JPJ | Predicted | e6jpjA1 | |||
| 6NVG | Predicted | e6nvgA1 | |||
| 6NVH | Predicted | e6nvhA1 | |||
| 6NVI | Predicted | e6nviA1 | |||
| 6NVJ | Predicted | e6nvjA1 | |||
| 6NVK | Predicted | e6nvkA1 |