DB08846 Ellagic acid
InChI Key: AFSDNFLWKVMVRB-UHFFFAOYSA-N
SMILES: OC1=C(O)C2=C3C(=C1)C(=O)OC1=C3C(=CC(O)=C1O)C(=O)O2
Small molecule PDB accession : REF
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P22748
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P22748 | Download | Predicted | P22748_nD1 | Carbonic anhydrase | |
| 1ZNC | Predicted | e1zncA1 e1zncB1 | |||
| 3F7B | Predicted | e3f7bA1 e3f7bB1 | |||
| 3F7U | Predicted | e3f7uA1 e3f7uB1 e3f7uC1 e3f7uD1 | |||
| 3FW3 | Predicted | e3fw3A1 e3fw3B1 | |||
| 5IPZ | Predicted | e5ipzA1 e5ipzB1 e5ipzC1 e5ipzD1 | |||
| 5JN8 | Predicted | e5jn8A1 e5jn8C1 e5jn8B1 e5jn8D1 | |||
| 5JN9 | Predicted | e5jn9A1 e5jn9C1 e5jn9B1 e5jn9D1 | |||
| 5JNA | Predicted | e5jnaA1 e5jnaC1 e5jnaB1 e5jnaD1 | |||
| 5JNC | Predicted | e5jncA1 e5jncC1 e5jncB1 e5jncD1 | |||
| 5KU6 | Predicted | e5ku6A1 e5ku6B1 e5ku6C1 e5ku6D1 |