DB03769 D-Eritadenine
InChI Key: LIEMBEWXEZJEEZ-INEUFUBQSA-N
SMILES: [H][C@@](O)(CN1C=NC2=C(N)N=CN=C12)[C@@]([H])(O)C(O)=O
Small molecule PDB accession : DEA
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P23526
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P23526 | Download | Predicted | P23526_nD1 P23526_nD2 | Rossmann-like Rossmann-like | |
| 1A7A | Predicted | e1a7aB1 e1a7aA1 e1a7aA2 e1a7aB2 | |||
| 1LI4 | Predicted | e1li4A1 e1li4A2 | |||
| 3NJ4 | Predicted | e3nj4A1 e3nj4B1 e3nj4C1 e3nj4D1 e3nj4A2 e3nj4B2 e3nj4C2 e3nj4D2 | |||
| 4PFJ | Predicted | e4pfjA1 e4pfjB1 e4pfjA2 e4pfjB2 | |||
| 4PGF | Predicted | e4pgfA1 e4pgfB1 e4pgfA2 e4pgfB2 | |||
| 4YVF | Predicted | e4yvfA2 e4yvfB1 e4yvfA1 e4yvfB2 | |||
| 5W49 | Predicted | e5w49A1 e5w49B2 e5w49A2 e5w49B1 | |||
| 5W4B | Predicted | e5w4bA2 e5w4bB1 e5w4bC1 e5w4bD1 e5w4bE1 e5w4bF1 e5w4bA1 e5w4bB2 e5w4bC2 e5w4bD2 e5w4bE2 e5w4bF2 |