DB04214 4-Nitrophenyl Phosphate
InChI Key: XZKIHKMTEMTJQX-UHFFFAOYSA-N
SMILES: OP(O)(=O)OC1=CC=C(C=C1)[N+]([O-])=O
Small molecule PDB accession : 4NP
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P24666
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P24666 | Download | Predicted | P24666_nD1 | Flavodoxin-like | |
| 1XWW | Predicted | e1xwwA1 | |||
| 3N8I | Predicted | e3n8iA1 | |||
| 4Z99 | Predicted | e4z99A1 | |||
| 4Z9A | Predicted | e4z9aA1 | |||
| 4Z9B | Predicted | e4z9bA1 | |||
| 5JNR | Predicted | e5jnrA1 | |||
| 5JNS | Predicted | e5jnsA1 | |||
| 5JNT | Predicted | e5jntA1 | |||
| 5KQG | Predicted | e5kqgA1 | |||
| 5KQL | Predicted | e5kqlA1 | |||
| 5KQM | Predicted | e5kqmA1 | |||
| 5KQP | Predicted | e5kqpA1 | |||
| 5PNT | Predicted | e5pntA1 |