DB08889 Carfilzomib
InChI Key: BLMPQMFVWMYDKT-NZTKNTHTSA-N
SMILES: CC(C)C[C@H](NC(=O)[C@H](CCC1=CC=CC=C1)NC(=O)CN1CCOCC1)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P28062
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P28062 | Download | Predicted | P28062_nD1 | Ntn/PP2C | |
| 5L5A | Predicted | e5l5aK1 | |||
| 5L5B | Predicted | e5l5bK1 e5l5bY1 | |||
| 5L5D | Predicted | e5l5dY1 | |||
| 5L5H | Predicted | e5l5hY1 | |||
| 5L5I | Predicted | e5l5iK1 e5l5iY1 | |||
| 5L5J | Predicted | e5l5jY1 | |||
| 5L5O | Predicted | e5l5oK1 e5l5oY1 | |||
| 5L5P | Predicted | e5l5pK1 | |||
| 5L5Q | Predicted | e5l5qK1 e5l5qY1 | |||
| 5L5R | Predicted | e5l5rK1 | |||
| 5L5S | Predicted | e5l5sK1 e5l5sY1 | |||
| 5L5U | Predicted | e5l5uY1 | |||
| 5L5V | Predicted | e5l5vY1 | |||
| 5LTT | Predicted | e5lttK1 | |||
| 5M2B | Predicted | e5m2bK1 | |||
| 6AVO | Predicted | e6avoC1 e6avoD1 | |||
| 6E5B | Predicted | e6e5bK1 e6e5bY1 |