DB07905 Hypothemycin
InChI Key: SSNQAUBBJYCSMY-KNTMUCJRSA-N
SMILES: [H]\C1=C([H])\C(=O)[C@@H](O)[C@@H](O)C[C@H]2O[C@@H]2C2=C(C(O)=CC(OC)=C2)C(=O)O[C@@H](C)C1
Small molecule PDB accession : HMY
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P28482
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P28482 | Download | Predicted | P28482_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 1PME | Predicted | e1pmeA1 | |||
| 1TVO | Predicted | e1tvoA1 | |||
| 1WZY | Predicted | e1wzyA1 | |||
| 2OJG | Predicted | e2ojgA1 | |||
| 2OJI | Predicted | e2ojiA1 | |||
| 2OJJ | Predicted | e2ojjA1 | |||
| 2Y9Q | Predicted | e2y9qA1 | |||
| 3I5Z | Predicted | e3i5zA1 | |||
| 3I60 | Predicted | e3i60A1 | |||
| 3SA0 | Predicted | e3sa0A1 | |||
| 3TEI | Predicted | e3teiA1 | |||
| 3W55 | Predicted | e3w55A1 | |||
| 4FMQ | Predicted | e4fmqA1 | |||
| 4FUX | Predicted | e4fuxA1 | |||
| 4FUY | Predicted | e4fuyA2 | |||
| 4FV0 | Predicted | e4fv0A2 | |||
| 4FV1 | Predicted | e4fv1A2 | |||
| 4FV2 | Predicted | e4fv2A1 | |||
| 4FV3 | Predicted | e4fv3A2 | |||
| 4FV4 | Predicted | e4fv4A2 | |||
| 4FV5 | Predicted | e4fv5A2 | |||
| 4FV6 | Predicted | e4fv6A2 | |||
| 4FV7 | Predicted | e4fv7A2 | |||
| 4FV8 | Predicted | e4fv8A2 | |||
| 4FV9 | Predicted | e4fv9A2 | |||
| 4G6N | Predicted | e4g6nA1 | |||
| 4G6O | Predicted | e4g6oA2 | |||
| 4H3P | Predicted | e4h3pA1 e4h3pD1 | |||
| 4H3Q | Predicted | e4h3qA1 | |||
| 4IZ5 | Predicted | e4iz5A1 e4iz5D1 e4iz5B1 e4iz5C1 | |||
| 4IZ7 | Predicted | e4iz7C2 e4iz7A2 | |||
| 4IZA | Predicted | e4izaA1 e4izaC2 | |||
| 4N0S | Predicted | e4n0sA1 | |||
| 4NIF | Predicted | e4nifB1 e4nifE1 | |||
| 4O6E | Predicted | e4o6eA1 | |||
| 4QP1 | Predicted | e4qp1A1 e4qp1B1 | |||
| 4QP2 | Predicted | e4qp2A1 e4qp2B1 | |||
| 4QP3 | Predicted | e4qp3A1 e4qp3B1 | |||
| 4QP4 | Predicted | e4qp4A1 e4qp4B1 | |||
| 4QP6 | Predicted | e4qp6A1 e4qp6B1 | |||
| 4QP7 | Predicted | e4qp7A1 e4qp7B1 | |||
| 4QP8 | Predicted | e4qp8B1 | |||
| 4QP9 | Predicted | e4qp9A1 | |||
| 4QPA | Predicted | e4qpaA1 e4qpaB1 | |||
| 4QTA | Predicted | e4qtaA1 | |||
| 4QTE | Predicted | e4qteA1 | |||
| 4XJ0 | Predicted | e4xj0A1 e4xj0B1 | |||
| 4ZXT | Predicted | e4zxtA1 | |||
| 4ZZM | Predicted | e4zzmA1 | |||
| 4ZZN | Predicted | e4zznA1 | |||
| 4ZZO | Predicted | e4zzoA1 | |||
| 5AX3 | Predicted | e5ax3A1 | |||
| 5BUE | Predicted | e5bueA1 | |||
| 5BUI | Predicted | e5buiA1 | |||
| 5BUJ | Predicted | e5bujA1 | |||
| 5BVD | Predicted | e5bvdA1 | |||
| 5BVE | Predicted | e5bveA1 | |||
| 5BVF | Predicted | e5bvfA1 | |||
| 5K4I | Predicted | e5k4iA1 | |||
| 5LCJ | Predicted | e5lcjA1 | |||
| 5LCK | Predicted | e5lckA1 | |||
| 5NGU | Predicted | e5nguA1 | |||
| 5NHF | Predicted | e5nhfA1 | |||
| 5NHH | Predicted | e5nhhA1 | |||
| 5NHJ | Predicted | e5nhjA1 | |||
| 5NHL | Predicted | e5nhlA1 | |||
| 5NHO | Predicted | e5nhoA1 | |||
| 5NHP | Predicted | e5nhpA1 | |||
| 5NHV | Predicted | e5nhvA1 | |||
| 5V60 | Predicted | e5v60A1 | |||
| 5V61 | Predicted | e5v61A1 | |||
| 5V62 | Predicted | e5v62A1 | |||
| 5WP1 | Predicted | e5wp1A1 | |||
| 6D5Y | Predicted | e6d5yA1 | |||
| 6DMG | Predicted | e6dmgA1 | |||
| 6G54 | Predicted | e6g54A1 | |||
| 6G8X | Predicted | e6g8xA1 | |||
| 6G91 | Predicted | e6g91A1 | |||
| 6G92 | Predicted | e6g92A1 | |||
| 6G93 | Predicted | e6g93A1 | |||
| 6G97 | Predicted | e6g97A1 | |||
| 6G9A | Predicted | e6g9aA1 | |||
| 6G9D | Predicted | e6g9dA1 | |||
| 6G9H | Predicted | e6g9hA1 | |||
| 6G9J | Predicted | e6g9jA1 | |||
| 6G9K | Predicted | e6g9kA1 | |||
| 6G9M | Predicted | e6g9mA1 | |||
| 6G9N | Predicted | e6g9nA1 | |||
| 6GDM | Predicted | e6gdmA1 | |||
| 6GDQ | Predicted | e6gdqA1 | |||
| 6GE0 | Predicted | e6ge0A1 | |||
| 6GJB | Predicted | e6gjbA1 | |||
| 6GJD | Predicted | e6gjdA1 | |||
| 6NBS | Predicted | e6nbsA1 | |||
| 6OPG | Predicted | e6opgA1 | |||
| 6OPH | Predicted | e6ophA1 | |||
| 6OPI | Predicted | e6opiA1 | |||
| 6Q7K | Predicted | e6q7kA1 | |||
| 6Q7S | Predicted | e6q7sA1 | |||
| 6Q7T | Predicted | e6q7tA1 | |||
| 6QA1 | Predicted | e6qa1A1 | |||
| 6QA3 | Predicted | e6qa3A1 | |||
| 6QA4 | Predicted | e6qa4A1 | |||
| 6QAG | Predicted | e6qagA1 | |||
| 6QAH | Predicted | e6qahA1 | |||
| 6QAL | Predicted | e6qalA1 | |||
| 6QAQ | Predicted | e6qaqA1 | |||
| 6QAW | Predicted | e6qawA1 | |||
| 6RQ4 | Predicted | e6rq4A1 | |||
| 6SLG | Predicted | e6slgA1 |