DB14132 8-chlorotheophylline
InChI Key: RYIGNEOBDRVTHA-UHFFFAOYSA-N
SMILES: CN1C2=C(NC(Cl)=N2)C(=O)N(C)C1=O
Small molecule PDB accession : H33
Drug action: antagonist
List of PDB structures and/or AlphaFold models with target protein P29274
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P29274 | Download | Predicted | P29274_nD1 | Family A G protein-coupled receptor-like | |
2YDO | Predicted | e2ydoA3 | |||
2YDV | Predicted | e2ydvA1 | |||
3EML | Predicted | e3emlA4 e3emlA3 | |||
3PWH | Predicted | e3pwhA3 | |||
3REY | Predicted | e3reyA1 | |||
3RFM | Predicted | e3rfmA1 | |||
3UZA | Predicted | e3uzaA2 | |||
3UZC | Predicted | e3uzcA2 | |||
3VG9 | Predicted | e3vg9A2 | |||
3VGA | Predicted | e3vgaA2 | |||
4EIY | Predicted | e4eiyA3 e4eiyA2 | |||
4UG2 | Predicted | e4ug2A1 e4ug2B1 | |||
4UHR | Predicted | e4uhrA1 | |||
5G53 | Predicted | e5g53A1 e5g53B1 | |||
5IU7 | Predicted | e5iu7A1 e5iu7A2 | |||
5IU8 | Predicted | e5iu8A2 e5iu8A1 | |||
5IUB | Predicted | e5iubA2 e5iubA1 | |||
5K2A | Predicted | e5k2aA2 e5k2aA1 | |||
5K2B | Predicted | e5k2bA1 e5k2bA2 | |||
5K2D | Predicted | e5k2dA2 e5k2dA1 | |||
5MZJ | Predicted | e5mzjA1 | |||
5MZP | Predicted | e5mzpA1 | |||
5NLX | Predicted | e5nlxA1 | |||
5OLH | Predicted | e5olhA2 | |||
5OLV | Predicted | e5olvA2 | |||
5OM1 | Predicted | e5om1A2 | |||
5OM4 | Predicted | e5om4A2 | |||
5UIG | Predicted | e5uigA2 | |||
5VRA | Predicted | e5vraA2 | |||
5WF5 | Predicted | e5wf5A2 | |||
5WF6 | Predicted | e5wf6A1 | |||
6AQF | Predicted | e6aqfA1 | |||
6GDG | Predicted | e6gdgA1 |