DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P29320
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P29320 | Download | Predicted | P29320_nD1 P29320_nD6 P29320_nD7 P29320_nD2 | jelly-roll Protein kinase/SAICAR synthase/ATP-grasp HhH/H2TH EGF-like | |
2GSF | Predicted | e2gsfA1 | |||
2QO2 | Predicted | e2qo2A1 | |||
2QO7 | Predicted | e2qo7A2 | |||
2QO9 | Predicted | e2qo9A1 | |||
2QOB | Predicted | e2qobA1 | |||
2QOC | Predicted | e2qocA1 | |||
2QOD | Predicted | e2qodA1 | |||
2QOF | Predicted | e2qofA1 | |||
2QOI | Predicted | e2qoiA1 | |||
2QOK | Predicted | e2qokA1 | |||
2QOL | Predicted | e2qolA2 | |||
2QON | Predicted | e2qonA2 | |||
2QOO | Predicted | e2qooA1 | |||
2QOQ | Predicted | e2qoqA1 | |||
3DZQ | Predicted | e3dzqA1 | |||
3FXX | Predicted | e3fxxA1 | |||
3FY2 | Predicted | e3fy2A1 | |||
4G2F | Predicted | e4g2fA1 | |||
4GK2 | Predicted | e4gk2A2 | |||
4GK3 | Predicted | e4gk3A1 | |||
4GK4 | Predicted | e4gk4A2 | |||
4L0P | Predicted | e4l0pA1 | |||
4P4C | Predicted | e4p4cA1 | |||
4P5Q | Predicted | e4p5qA1 | |||
4P5Z | Predicted | e4p5zA1 | |||
4TWN | Predicted | e4twnA1 | |||
4TWO | Predicted | e4twoA1 | |||
6IN0 | Predicted | e6in0A1 |