DB02506 2,6,8-Trimethyl-3-Amino-9-Benzyl-9-Methoxynonanoic Acid
InChI Key: SWTFXINHZPXNOX-DZBHQSCQSA-N
SMILES: [H][C@@](C)(CC[C@]([H])(N)[C@]([H])(C)C(O)=O)C[C@]([H])(C)[C@]([H])(CC1=CC=CC=C1)OC
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P30153
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P30153 | Download | Predicted | P30153_nD1 | Repetitive alpha hairpins | |
| 1B3U | Predicted | e1b3uA1 e1b3uB1 | |||
| 2IE3 | Predicted | e2ie3A1 | |||
| 2IE4 | Predicted | e2ie4A1 | |||
| 2NPP | Predicted | e2nppA1 e2nppD1 | |||
| 2NYL | Predicted | e2nylA1 e2nylD1 | |||
| 2NYM | Predicted | e2nymA1 e2nymD1 | |||
| 2PKG | Predicted | e2pkgA1 e2pkgB1 | |||
| 3C5W | Predicted | e3c5wA1 | |||
| 3DW8 | Predicted | e3dw8A1 e3dw8D1 | |||
| 3K7V | Predicted | e3k7vA1 | |||
| 3K7W | Predicted | e3k7wA1 | |||
| 4I5L | Predicted | e4i5lA1 e4i5lD1 | |||
| 4I5N | Predicted | e4i5nA1 e4i5nD1 | |||
| 4LAC | Predicted | e4lacA1 | |||
| 5W0W | Predicted | e5w0wG1 e5w0wA1 e5w0wD1 e5w0wJ1 | |||
| 6IUR | Predicted | e6iurA1 e6iurB1 e6iurE1 e6iurF1 |