DB06905 (2S,3S,4E,6E,8S,9S)-3-amino-9-methoxy-2,6,8-trimethyl-10-phenyldeca-4,6-dienoic acid
InChI Key: HJVCHYDYCYBBQX-HLTLHRPFSA-N
SMILES: [H][C@](C)(\C=C(/C)\C=C\[C@]([H])(N)[C@]([H])(C)C(O)=O)[C@]([H])(CC1=CC=CC=C1)OC
Small molecule PDB accession : 1ZN
Drug action: n/a
List of drug binding-associated PTMs
List of PDB structures and/or AlphaFold models with target protein P30153
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P30153 | Download | Predicted |
P30153_nD1 |
Repetitive alpha hairpins
|
|
| 1B3U | Predicted |
e1b3uA1 e1b3uB1 |
|||
| 2IE3 | Predicted |
e2ie3A1 |
|||
| 2IE4 | Predicted |
e2ie4A1 |
|||
| 2NPP | Predicted |
e2nppA1 e2nppD1 |
|||
| 2NYL | Predicted |
e2nylA1 e2nylD1 |
|||
| 2NYM | Predicted |
e2nymA1 e2nymD1 |
|||
| 2PKG | Predicted |
e2pkgA1 e2pkgB1 |
|||
| 3C5W | Predicted |
e3c5wA1 |
|||
| 3DW8 | Predicted |
e3dw8A1 e3dw8D1 |
|||
| 3K7V | Predicted |
e3k7vA1 |
|||
| 3K7W | Predicted |
e3k7wA1 |
|||
| 4I5L | Predicted |
e4i5lA1 e4i5lD1 |
|||
| 4I5N | Predicted |
e4i5nA1 e4i5nD1 |
|||
| 4LAC | Predicted |
e4lacA1 |
|||
| 5W0W | Predicted |
e5w0wG1 e5w0wA1 e5w0wD1 e5w0wJ1 |
|||
| 6IUR | Predicted |
e6iurA1 e6iurB1 e6iurE1 e6iurF1 |