DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P30291
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P30291 | Download | Predicted | P30291_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
1X8B | Predicted | e1x8bA2 | |||
2IN6 | Predicted | e2in6A2 | |||
2IO6 | Predicted | e2io6A2 | |||
2Z2W | Predicted | e2z2wA2 | |||
3BI6 | Predicted | e3bi6A2 | |||
3BIZ | Predicted | e3bizA2 | |||
3CQE | Predicted | e3cqeA2 | |||
3CR0 | Predicted | e3cr0A2 | |||
5V5Y | Predicted | e5v5yA1 | |||
5VC3 | Predicted | e5vc3A1 | |||
5VC4 | Predicted | e5vc4A1 | |||
5VC5 | Predicted | e5vc5A1 | |||
5VC6 | Predicted | e5vc6A1 | |||
5VD2 | Predicted | e5vd2A1 | |||
5VD4 | Predicted | e5vd4A1 | |||
5VD5 | Predicted | e5vd5A1 | |||
5VD7 | Predicted | e5vd7A1 | |||
5VD8 | Predicted | e5vd8A1 | |||
5VD9 | Predicted | e5vd9A1 | |||
5VDA | Predicted | e5vdaA1 |