DB01645 Genistein
InChI Key: TZBJGXHYKVUXJN-UHFFFAOYSA-N
SMILES: OC1=CC=C(C=C1)C1=COC2=C(C(O)=CC(O)=C2)C1=O
Small molecule PDB accession : GEN
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P31749
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P31749 | Download | Predicted | P31749_nD1 P31749_nD2 | PH domain-like Protein kinase/SAICAR synthase/ATP-grasp | |
1H10 | Predicted | e1h10A1 | |||
1UNP | Predicted | e1unpA1 | |||
1UNQ | Predicted | e1unqA1 | |||
1UNR | Predicted | e1unrA1 | |||
2UVM | Predicted | e2uvmA1 | |||
2UZR | Predicted | e2uzrA1 | |||
2UZS | Predicted | e2uzsA1 | |||
3CQU | Predicted | e3cquA1 | |||
3CQW | Predicted | e3cqwA1 | |||
3MV5 | Predicted | e3mv5A1 | |||
3MVH | Predicted | e3mvhA1 | |||
3O96 | Predicted | e3o96A2 e3o96A1 | |||
3OCB | Predicted | e3ocbA1 e3ocbB1 | |||
3OW4 | Predicted | e3ow4A1 e3ow4B1 | |||
3QKK | Predicted | e3qkkA1 | |||
3QKL | Predicted | e3qklA1 | |||
3QKM | Predicted | e3qkmA1 | |||
4EJN | Predicted | e4ejnA2 e4ejnA3 | |||
4EKK | Predicted | e4ekkA2 e4ekkB2 | |||
4EKL | Predicted | e4eklA2 | |||
4GV1 | Predicted | e4gv1A1 | |||
5KCV | Predicted | e5kcvA1 e5kcvA2 | |||
6BUU | Predicted | e6buuA1 e6buuB1 | |||
6CCY | Predicted | e6ccyA1 | |||
6HHF | Predicted | e6hhfA2 e6hhfA1 | |||
6HHG | Predicted | e6hhgA1 e6hhgA2 | |||
6HHH | Predicted | e6hhhA1 e6hhhA2 | |||
6HHI | Predicted | e6hhiA1 e6hhiA2 | |||
6HHJ | Predicted | e6hhjA2 e6hhjA1 | |||
6NPZ | Predicted | e6npzA1 e6npzB1 | |||
6S9W | Predicted | e6s9wA2 e6s9wA1 | |||
6S9X | Predicted | e6s9xA2 e6s9xA1 |