DB03637 Guanidine-3-propanol
InChI Key: JDXXTKLHHZMVIO-UHFFFAOYSA-O
SMILES: [H]N([H])C(N([H])[H])=[N+]([H])CCCO
Small molecule PDB accession : PG3
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P35030
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P35030 | Download | Predicted | P35030_nD1 | cradle loop barrel | |
| 1H4W | Predicted | e1h4wA1 | |||
| 2R9P | Predicted | e2r9pA1 e2r9pB1 e2r9pC1 e2r9pD1 | |||
| 3L33 | Predicted | e3l33A1 e3l33B1 e3l33C1 e3l33D1 | |||
| 3L3T | Predicted | e3l3tA1 e3l3tB1 e3l3tC1 e3l3tD1 | |||
| 3P92 | Predicted | e3p92A1 | |||
| 3P95 | Predicted | e3p95A1 | |||
| 4DG4 | Predicted | e4dg4A1 e4dg4D1 e4dg4B1 e4dg4G1 | |||
| 4U30 | Predicted | e4u30A1 e4u30B1 e4u30C1 e4u30D1 | |||
| 4U32 | Predicted | e4u32A1 | |||
| 5C67 | Predicted | e5c67A1 e5c67B1 | |||
| 5JBT | Predicted | e5jbtA1 | |||
| 5TP0 | Predicted | e5tp0A1 | |||
| 6BX8 | Predicted | e6bx8A1 e6bx8C1 e6bx8E1 e6bx8G1 | |||
| 6GFI | Predicted | e6gfiA1 e6gfiB1 |