DB08896 Regorafenib
InChI Key: FNHKPVJBJVTLMP-UHFFFAOYSA-N
SMILES: CNC(=O)C1=CC(OC2=CC(F)=C(NC(=O)NC3=CC=C(Cl)C(=C3)C(F)(F)F)C=C2)=CC=N1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P35968
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P35968 | Download | Predicted | P35968_nD3 P35968_nD9 P35968_nD4 P35968_nD5 | Immunoglobulin-like beta-sandwich Protein kinase/SAICAR synthase/ATP-grasp Immunoglobulin-like beta-sandwich Immunoglobulin-like beta-sandwich | |
1VR2 | Predicted | e1vr2A1 | |||
1Y6A | Predicted | e1y6aA1 | |||
1Y6B | Predicted | e1y6bA1 | |||
1YWN | Predicted | e1ywnA1 | |||
2MET | Predicted | e2metA1 e2metB1 e2metC1 | |||
2MEU | Predicted | e2meuA1 e2meuB1 | |||
2OH4 | Predicted | e2oh4A1 | |||
2P2H | Predicted | e2p2hA1 | |||
2P2I | Predicted | e2p2iA1 e2p2iB1 | |||
2QU5 | Predicted | e2qu5A1 | |||
2QU6 | Predicted | e2qu6A2 e2qu6B1 | |||
2RL5 | Predicted | e2rl5A1 | |||
2X1W | Predicted | e2x1wM1 e2x1wN1 e2x1wO1 e2x1wL4 e2x1wO2 e2x1wN2 e2x1wM2 e2x1wL3 | |||
2X1X | Predicted | e2x1xR4 e2x1xR3 | |||
2XIR | Predicted | e2xirA1 | |||
3B8Q | Predicted | e3b8qB1 e3b8qA2 | |||
3B8R | Predicted | e3b8rA1 e3b8rB1 | |||
3BE2 | Predicted | e3be2A2 | |||
3C7Q | Predicted | e3c7qA1 | |||
3CJF | Predicted | e3cjfA1 | |||
3CJG | Predicted | e3cjgA1 | |||
3CP9 | Predicted | e3cp9A1 e3cp9B1 | |||
3CPB | Predicted | e3cpbB1 e3cpbA2 | |||
3CPC | Predicted | e3cpcB1 e3cpcA2 | |||
3DTW | Predicted | e3dtwB1 e3dtwA2 | |||
3EFL | Predicted | e3eflB1 e3eflA2 | |||
3EWH | Predicted | e3ewhA1 | |||
3KVQ | Predicted | e3kvqA1 | |||
3S35 | Predicted | e3s35X1 | |||
3S36 | Predicted | e3s36X1 | |||
3S37 | Predicted | e3s37X1 | |||
3U6J | Predicted | e3u6jA1 | |||
3VHE | Predicted | e3vheA1 | |||
3VHK | Predicted | e3vhkA1 | |||
3VID | Predicted | e3vidA1 | |||
3VNT | Predicted | e3vntA1 | |||
3VO3 | Predicted | e3vo3A1 | |||
3WZD | Predicted | e3wzdA1 | |||
3WZE | Predicted | e3wzeA1 | |||
4AG8 | Predicted | e4ag8A1 | |||
4AGC | Predicted | e4agcA1 | |||
4AGD | Predicted | e4agdA2 | |||
4ASD | Predicted | e4asdA2 | |||
4ASE | Predicted | e4aseA2 | |||
5EW3 | Predicted | e5ew3A1 | |||
5OYJ | Predicted | e5oyjD1 e5oyjC1 e5oyjD2 e5oyjC2 | |||
6GQO | Predicted | e6gqoA1 | |||
6GQP | Predicted | e6gqpA1 | |||
6GQQ | Predicted | e6gqqA1 |