DB11638 Artenimol
InChI Key: BJDCWCLMFKKGEE-HVDUHBCDSA-N
SMILES: [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4
Small molecule PDB accession : n/a
Drug action: ligand
List of PDB structures and/or AlphaFold models with target protein P36578
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P36578 | Download | Predicted | P36578_nD1 | Ribosomal protein L4 | |
| 4UG0 | Predicted | ||||
| 4V6X | Predicted | ||||
| 5A8L | Predicted | ||||
| 5AJ0 | Predicted | ||||
| 5LKS | Predicted | ||||
| 5T2C | Predicted | ||||
| 6IP5 | Predicted | ||||
| 6IP6 | Predicted | ||||
| 6IP8 | Predicted | ||||
| 6LQM | Predicted | ||||
| 6LSR | Predicted | ||||
| 6LSS | Predicted | ||||
| 6LU8 | Predicted | ||||
| 6OLE | Predicted | ||||
| 6OLF | Predicted | ||||
| 6OLG | Predicted | ||||
| 6OLI | Predicted | ||||
| 6OLZ | Predicted | ||||
| 6OM0 | Predicted | ||||
| 6OM7 | Predicted | ||||
| 6QZP | Predicted | ||||
| 6W6L | Predicted | ||||
| 6XA1 | Predicted | ||||
| 6Y0G | Predicted | ||||
| 6Y2L | Predicted | ||||
| 6Y57 | Predicted | ||||
| 6Y6X | Predicted | ||||
| 6Z6L | Predicted | ||||
| 6Z6M | Predicted | ||||
| 6Z6N | Predicted | ||||
| 6ZM7 | Predicted | ||||
| 6ZME | Predicted | ||||
| 6ZMI | Predicted | ||||
| 6ZMO | Predicted | ||||
| 7BHP | Predicted |