DB12010 Fostamatinib
InChI Key: GKDRMWXFWHEQQT-UHFFFAOYSA-N
SMILES: COC1=CC(NC2=NC=C(F)C(NC3=NC4=C(OC(C)(C)C(=O)N4COP(O)(O)=O)C=C3)=N2)=CC(OC)=C1OC
Small molecule PDB accession : 2RC
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P36897
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P36897 | Download | Predicted | P36897_nD2 | Protein kinase/SAICAR synthase/ATP-grasp | |
1B6C | Predicted | e1b6cF1 e1b6cH1 e1b6cD1 e1b6cB1 | |||
1IAS | Predicted | e1iasA1 e1iasB1 e1iasC1 e1iasD1 e1iasE1 | |||
1PY5 | Predicted | e1py5A1 | |||
1RW8 | Predicted | e1rw8A1 | |||
1VJY | Predicted | e1vjyA1 | |||
2L5S | Predicted | e2l5sA1 | |||
2PJY | Predicted | e2pjyC1 | |||
2WOT | Predicted | e2wotA1 | |||
2WOU | Predicted | e2wouA1 | |||
2X7O | Predicted | e2x7oA1 e2x7oB1 e2x7oC1 e2x7oD1 e2x7oE1 | |||
3FAA | Predicted | e3faaA1 e3faaB1 e3faaC1 e3faaD1 e3faaE1 | |||
3GXL | Predicted | e3gxlA1 | |||
3HMM | Predicted | e3hmmA1 | |||
3KCF | Predicted | e3kcfA1 e3kcfB1 e3kcfC1 e3kcfD1 e3kcfE1 | |||
3KFD | Predicted | e3kfdI1 e3kfdJ1 e3kfdK1 e3kfdL1 | |||
3TZM | Predicted | e3tzmA1 | |||
4X0M | Predicted | e4x0mA1 | |||
4X2F | Predicted | e4x2fA1 | |||
4X2G | Predicted | e4x2gA1 | |||
4X2J | Predicted | e4x2jA1 | |||
4X2K | Predicted | e4x2kA1 | |||
4X2N | Predicted | e4x2nA1 | |||
5E8S | Predicted | e5e8sA1 | |||
5E8T | Predicted | e5e8tA1 | |||
5E8U | Predicted | e5e8uA1 | |||
5E8W | Predicted | e5e8wA1 | |||
5E8X | Predicted | e5e8xA1 | |||
5E8Z | Predicted | e5e8zA1 | |||
5E90 | Predicted | e5e90A1 | |||
5FRI | Predicted | e5friA1 | |||
5QIK | Predicted | e5qikA1 | |||
5QIL | Predicted | e5qilA1 | |||
5QIM | Predicted | e5qimA1 | |||
5USQ | Predicted | e5usqA1 | |||
6B8Y | Predicted | e6b8yA1 | |||
6MAC | Predicted | e6macK1 |