DB07374 Anisomycin
InChI Key: YKJYKKNCCRKFSL-RDBSUJKOSA-N
SMILES: [H][C@]1(O)CN[C@]([H])(CC2=CC=C(OC)C=C2)[C@]1([H])OC(C)=O
Small molecule PDB accession : ANM
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P39023
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P39023 | Download | Predicted | P39023_nD1 | cradle loop barrel | |
4UG0 | Predicted | e4ug0LB1 | |||
4V6X | Predicted | e4v6xCB1 | |||
5AJ0 | Predicted | e5aj0AB1 | |||
5LKS | Predicted | e5lksLB1 | |||
5T2C | Predicted | e5t2cE1 | |||
6IP5 | Predicted | e6ip51E1 | |||
6IP6 | Predicted | e6ip61E1 | |||
6IP8 | Predicted | e6ip81E1 | |||
6OLE | Predicted | e6oleB1 | |||
6OLF | Predicted | e6olfB1 | |||
6OLG | Predicted | e6olgAB1 | |||
6OLI | Predicted | e6oliB1 | |||
6OLZ | Predicted | e6olzAB1 | |||
6OM0 | Predicted | e6om0B1 | |||
6OM7 | Predicted | e6om7B1 | |||
6QZP | Predicted | e6qzpLB1 |