DB07374 Anisomycin
InChI Key: YKJYKKNCCRKFSL-RDBSUJKOSA-N
SMILES: [H][C@]1(O)CN[C@]([H])(CC2=CC=C(OC)C=C2)[C@]1([H])OC(C)=O
Small molecule PDB accession : ANM
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P40429
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P40429 | Download | Predicted | P40429_nD1 | Ribosomal protein L13/L15p/L18e/L32e | |
4UG0 | Predicted | e4ug0LO1 | |||
4V6X | Predicted | e4v6xCO1 | |||
5AJ0 | Predicted | e5aj0AO1 | |||
5LKS | Predicted | e5lksLO1 | |||
5T2C | Predicted | e5t2cI1 | |||
6IP5 | Predicted | e6ip52I1 | |||
6IP6 | Predicted | e6ip62I1 | |||
6IP8 | Predicted | e6ip82I1 | |||
6OLE | Predicted | e6oleP1 | |||
6OLF | Predicted | e6olfP1 | |||
6OLG | Predicted | e6olgAO1 | |||
6OLI | Predicted | e6oliP1 | |||
6OLZ | Predicted | e6olzAO1 | |||
6OM0 | Predicted | e6om0P1 | |||
6OM7 | Predicted | e6om7P1 | |||
6QZP | Predicted | e6qzpLO1 |