DB08437 Puromycin
InChI Key: RXWNCPJZOCPEPQ-NVWDDTSBSA-N
SMILES: COC1=CC=C(C[C@H](N)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1
Small molecule PDB accession : PUY
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P40429
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P40429 | Download | Predicted | P40429_nD1 | Ribosomal protein L13/L15p/L18e/L32e | |
| 4UG0 | Predicted | e4ug0LO1 | |||
| 4V6X | Predicted | e4v6xCO1 | |||
| 5AJ0 | Predicted | e5aj0AO1 | |||
| 5LKS | Predicted | e5lksLO1 | |||
| 5T2C | Predicted | e5t2cI1 | |||
| 6IP5 | Predicted | e6ip52I1 | |||
| 6IP6 | Predicted | e6ip62I1 | |||
| 6IP8 | Predicted | e6ip82I1 | |||
| 6OLE | Predicted | e6oleP1 | |||
| 6OLF | Predicted | e6olfP1 | |||
| 6OLG | Predicted | e6olgAO1 | |||
| 6OLI | Predicted | e6oliP1 | |||
| 6OLZ | Predicted | e6olzAO1 | |||
| 6OM0 | Predicted | e6om0P1 | |||
| 6OM7 | Predicted | e6om7P1 | |||
| 6QZP | Predicted | e6qzpLO1 |