DB00162 Vitamin A
InChI Key: FPIPGXGPPPQFEQ-OVSJKPMPSA-N
SMILES: C\C(=C/CO)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C
Small molecule PDB accession : RTL
Drug action: ligand
List of PDB structures and/or AlphaFold models with target protein P41222
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P41222 | Download | Predicted | P41222_nD1 | Lipocalins/Streptavidin | |
| 2WWP | Predicted | e2wwpA1 e2wwpB1 | |||
| 3O19 | Predicted | e3o19A1 | |||
| 3O22 | Predicted | e3o22A1 | |||
| 3O2Y | Predicted | e3o2yA1 e3o2yB1 | |||
| 4IMN | Predicted | e4imnA2 | |||
| 4IMO | Predicted | e4imoA1 | |||
| 4ORR | Predicted | e4orrA1 | |||
| 4ORS | Predicted | e4orsA1 e4orsB1 | |||
| 4ORU | Predicted | e4oruA1 e4oruB1 | |||
| 4ORW | Predicted | e4orwA1 e4orwB1 | |||
| 4ORX | Predicted | e4orxA1 e4orxB1 | |||
| 4ORY | Predicted | e4oryA1 e4oryB1 e4oryC1 e4oryD1 e4oryE1 e4oryF1 e4oryG1 e4oryH1 | |||
| 4OS0 | Predicted | e4os0A1 e4os0B1 | |||
| 4OS3 | Predicted | e4os3A1 e4os3B1 | |||
| 4OS8 | Predicted | e4os8A1 e4os8B1 | |||
| 5WY9 | Predicted | e5wy9A1 |