DB00157 NADH
InChI Key: BOPGDPNILDQYTO-NNYOXOHSSA-N
SMILES: NC(=O)C1=CN(C=CC1)[C@@H]1O[C@H](CO[P@](O)(=O)O[P@](O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C(N)N=CN=C23)[C@@H](O)[C@H]1O
Small molecule PDB accession : NAI
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P42330
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P42330 | Download | Predicted | P42330_nD1 | TIM beta/alpha-barrel | |
| 1RY0 | Predicted | e1ry0A1 e1ry0B1 | |||
| 1RY8 | Predicted | e1ry8B1 e1ry8A1 | |||
| 1S1P | Predicted | e1s1pA1 | |||
| 1S1R | Predicted | e1s1rA1 | |||
| 1S2A | Predicted | e1s2aA1 | |||
| 1S2C | Predicted | e1s2cA1 | |||
| 1XF0 | Predicted | e1xf0A1 | |||
| 1ZQ5 | Predicted | e1zq5A1 | |||
| 2F38 | Predicted | e2f38A1 | |||
| 2FGB | Predicted | e2fgbA1 | |||
| 3R43 | Predicted | e3r43A1 | |||
| 3R58 | Predicted | e3r58A1 | |||
| 3R6I | Predicted | e3r6iA1 | |||
| 3R7M | Predicted | e3r7mA1 | |||
| 3R8G | Predicted | e3r8gA1 | |||
| 3R8H | Predicted | e3r8hA1 | |||
| 3R94 | Predicted | e3r94A1 | |||
| 3UFY | Predicted | e3ufyA1 | |||
| 3UG8 | Predicted | e3ug8A1 | |||
| 3UGR | Predicted | e3ugrA1 | |||
| 3UWE | Predicted | e3uweA1 | |||
| 4DBS | Predicted | e4dbsA1 e4dbsB1 | |||
| 4DBU | Predicted | e4dbuA1 e4dbuB1 | |||
| 4DBW | Predicted | e4dbwB1 e4dbwA1 | |||
| 4DZ5 | Predicted | e4dz5A1 | |||
| 4FA3 | Predicted | e4fa3A1 | |||
| 4FAL | Predicted | e4falA1 | |||
| 4FAM | Predicted | e4famA1 e4famB1 | |||
| 4H7C | Predicted | e4h7cA1 | |||
| 4HMN | Predicted | e4hmnA1 | |||
| 4WDT | Predicted | e4wdtA1 | |||
| 4WDU | Predicted | e4wduA1 | |||
| 4WDW | Predicted | e4wdwA1 e4wdwB1 | |||
| 4WDX | Predicted | e4wdxA1 e4wdxB1 | |||
| 4WRH | Predicted | e4wrhA1 | |||
| 4XVD | Predicted | e4xvdA1 e4xvdB1 | |||
| 4XVE | Predicted | e4xveA1 | |||
| 4YVV | Predicted | e4yvvA1 e4yvvB1 | |||
| 4YVX | Predicted | e4yvxA1 e4yvxB1 | |||
| 4ZFC | Predicted | e4zfcA1 e4zfcB1 | |||
| 5HNT | Predicted | e5hntA1 e5hntC1 | |||
| 5HNU | Predicted | e5hnuA1 e5hnuC1 | |||
| 6A7B | Predicted | e6a7bA1 e6a7bB1 | |||
| 6F2U | Predicted | e6f2uA1 e6f2uB1 | |||
| 6F78 | Predicted | e6f78B1 e6f78A1 | |||
| 6GXK | Predicted | e6gxkA1 e6gxkB1 |