DB14027 Taspoglutide
InChI Key: WRGVLTAWMNZWGT-VQSPYGJZSA-N
SMILES: CC[C@H](C)[C@H](NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](CCC(O)=O)NC(=O)C(C)(C)NC(=O)[C@@H](N)CC1=CNC=N1)[C@@H](C)O)[C@@H](C)O)C(C)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC1=CNC2=C1C=CC=C2)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCCCN)C(=O)NC(C)(C)C(=O)N[C@@H](CCCNC(N)=N)C(N)=O
Small molecule PDB accession : n/a
Drug action: agonist
List of PDB structures and/or AlphaFold models with target protein P43220
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P43220 | Download | Predicted | P43220_nD2 P43220_nD1 | Family A G protein-coupled receptor-like Hormone receptor domain (HRM, Pfam 02793) | |
| 3C59 | Predicted | e3c59A1 | |||
| 3C5T | Predicted | e3c5tA1 | |||
| 3IOL | Predicted | e3iolA1 | |||
| 4ZGM | Predicted | e4zgmA1 | |||
| 5E94 | Predicted | e5e94G1 e5e94H1 | |||
| 5NX2 | Predicted | e5nx2A2 e5nx2A1 | |||
| 5OTT | Predicted | e5ottA1 | |||
| 5OTU | Predicted | e5otuA1 e5otuC1 | |||
| 5OTV | Predicted | e5otvA1 e5otvC1 | |||
| 5OTW | Predicted | e5otwC1 e5otwA1 | |||
| 5OTX | Predicted | e5otxA1 e5otxC1 | |||
| 5VEW | Predicted | e5vewA2 e5vewB1 | |||
| 5VEX | Predicted | e5vexA2 e5vexB1 | |||
| 6B3J | Predicted | e6b3jR2 e6b3jR1 | |||
| 6GB1 | Predicted | e6gb1A1 | |||
| 6ORV | Predicted | e6orvRP1 |