DB03496 Alvocidib
InChI Key: BIIVYFLTOXDAOV-YVEFUNNKSA-N
SMILES: CN1CC[C@@H]([C@H](O)C1)C1=C(O)C=C(O)C2=C1OC(=CC2=O)C1=CC=CC=C1Cl
Small molecule PDB accession : CPB
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P49336
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P49336 | Download | Predicted | P49336_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
| 3RGF | Predicted | e3rgfA1 | |||
| 4CRL | Predicted | e4crlA1 | |||
| 4F6S | Predicted | e4f6sA2 | |||
| 4F6U | Predicted | e4f6uA2 | |||
| 4F6W | Predicted | e4f6wA2 | |||
| 4F70 | Predicted | e4f70A1 | |||
| 4F7J | Predicted | e4f7jA2 | |||
| 4F7L | Predicted | e4f7lA2 | |||
| 4F7N | Predicted | e4f7nA2 | |||
| 4F7S | Predicted | e4f7sA1 | |||
| 4G6L | Predicted | e4g6lA2 | |||
| 5BNJ | Predicted | e5bnjA1 | |||
| 5CEI | Predicted | e5ceiA1 | |||
| 5FGK | Predicted | e5fgkA1 | |||
| 5HBE | Predicted | e5hbeA1 | |||
| 5HBH | Predicted | e5hbhA1 | |||
| 5HBJ | Predicted | e5hbjA1 | |||
| 5HNB | Predicted | e5hnbA1 | |||
| 5HVY | Predicted | e5hvyA1 | |||
| 5I5Z | Predicted | e5i5zA1 | |||
| 5ICP | Predicted | e5icpA1 | |||
| 5IDN | Predicted | e5idnA1 | |||
| 5IDP | Predicted | e5idpA1 | |||
| 5XQX | Predicted | e5xqxA1 | |||
| 5XS2 | Predicted | e5xs2A1 | |||
| 6T41 | Predicted | e6t41A1 |