DB07216 (11S)-8-CHLORO-11-[1-(METHYLSULFONYL)PIPERIDIN-4-YL]-6-PIPERAZIN-1-YL-11H-BENZO[5,6]CYCLOHEPTA[1,2-B]PYRIDINE
InChI Key: ZMGCFGGMTCMSDP-QHCPKHFHSA-N
SMILES: [H][C@]1(C2CCN(CC2)S(C)(=O)=O)C2=C(C=C(Cl)C=C2)C(=CC2=C1N=CC=C2)N1CCNCC1
Small molecule PDB accession : 736
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P49354
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P49354 | Download | Predicted | P49354_nD1 | Repetitive alpha hairpins | |
| 1JCQ | Predicted | e1jcqA1 | |||
| 1LD7 | Predicted | e1ld7A1 | |||
| 1LD8 | Predicted | e1ld8A1 | |||
| 1MZC | Predicted | e1mzcA1 | |||
| 1S63 | Predicted | e1s63A1 | |||
| 1SA4 | Predicted | e1sa4A1 | |||
| 1TN6 | Predicted | e1tn6A1 | |||
| 2F0Y | Predicted | e2f0yA1 | |||
| 2H6F | Predicted | e2h6fA1 | |||
| 2H6G | Predicted | e2h6gA1 | |||
| 2H6H | Predicted | e2h6hA1 | |||
| 2H6I | Predicted | e2h6iA1 | |||
| 2IEJ | Predicted | e2iejA1 | |||
| 3E37 | Predicted | e3e37A1 |