DB02373 Adenosine monotungstate
InChI Key: FJSJQPRHXPUMLC-LRDMJOKZSA-L
SMILES: [H]N([H])C1=NC=NC2=C1N=CN2[C@]1([H])O[C@@]([H])(CO[W](O)(O)=O)[C@]([H])(O)[C@@]1([H])O
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P49789
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P49789 | Download | Predicted | P49789_nD1 | HIT-like | |
| 1FHI | Predicted | e1fhiA1 | |||
| 1FIT | Predicted | e1fitA1 | |||
| 2FHI | Predicted | e2fhiA1 | |||
| 2FIT | Predicted | e2fitA1 | |||
| 3FIT | Predicted | e3fitA1 | |||
| 4FIT | Predicted | e4fitA1 | |||
| 5FIT | Predicted | e5fitA1 | |||
| 6FIT | Predicted | e6fitA1 |