DB15442 Trilaciclib
InChI Key: PDGKHKMBHVFCMG-UHFFFAOYSA-N
SMILES: CN1CCN(CC1)C1=CN=C(NC2=NC3=C(C=C4N3C3(CCCCC3)CNC4=O)C=N2)C=C1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P50750
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P50750 | Download | Predicted | P50750_nD1 | Protein kinase/SAICAR synthase/ATP-grasp | |
3BLH | Predicted | e3blhA1 | |||
3BLQ | Predicted | e3blqA1 | |||
3BLR | Predicted | e3blrA1 | |||
3LQ5 | Predicted | e3lq5A1 | |||
3MI9 | Predicted | e3mi9A1 | |||
3MIA | Predicted | e3miaA1 | |||
3MY1 | Predicted | e3my1A1 | |||
3TN8 | Predicted | e3tn8A1 | |||
3TNH | Predicted | e3tnhA2 | |||
3TNI | Predicted | e3tniA1 | |||
4BCF | Predicted | e4bcfA1 | |||
4BCG | Predicted | e4bcgA1 | |||
4BCH | Predicted | e4bchA2 | |||
4BCI | Predicted | e4bciA1 | |||
4BCJ | Predicted | e4bcjA1 | |||
4EC8 | Predicted | e4ec8A1 | |||
4EC9 | Predicted | e4ec9A1 | |||
4IMY | Predicted | e4imyA1 e4imyC2 e4imyE2 | |||
4OGR | Predicted | e4ogrA1 e4ogrE1 e4ogrI1 | |||
4OR5 | Predicted | e4or5A1 e4or5F1 | |||
5L1Z | Predicted | e5l1zA1 | |||
6CYT | Predicted | e6cytA1 | |||
6GZH | Predicted | e6gzhA1 |