DB14973 Abrocitinib
InChI Key: IUEWXNHSKRWHDY-PHIMTYICSA-N
SMILES: CCCS(=O)(=O)N[C@H]1C[C@H](C1)N(C)C1=C2C=CNC2=NC=N1
Small molecule PDB accession : D7D
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P52333
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P52333 | Download | Predicted |
P52333_nD6 P52333_nD5 |
Protein kinase/SAICAR synthase/ATP-grasp
Protein kinase/SAICAR synthase/ATP-grasp |
|
1YVJ | Predicted |
e1yvjA1 |
|||
3LXK | Predicted |
e3lxkA1 |
|||
3LXL | Predicted |
e3lxlA1 |
|||
3PJC | Predicted |
e3pjcA1 |
|||
3ZC6 | Predicted |
e3zc6C1 e3zc6A1 e3zc6B1 e3zc6D1 |
|||
3ZEP | Predicted |
e3zepD1 e3zepA1 e3zepB1 e3zepC1 |
|||
4HVD | Predicted |
e4hvdA1 |
|||
4HVG | Predicted |
e4hvgA1 |
|||
4HVH | Predicted |
e4hvhA1 |
|||
4HVI | Predicted |
e4hviA1 |
|||
4I6Q | Predicted |
e4i6qA1 |
|||
4QPS | Predicted |
e4qpsC1 e4qpsA1 |
|||
4QT1 | Predicted |
e4qt1A1 |
|||
4RIO | Predicted |
e4rioA1 |
|||
4V0G | Predicted |
e4v0gA1 e4v0gB1 |
|||
4Z16 | Predicted |
e4z16A1 e4z16B1 e4z16C1 e4z16D1 |
|||
5LWM | Predicted |
e5lwmA1 |
|||
5LWN | Predicted |
e5lwnA1 |
|||
5TOZ | Predicted |
e5tozA1 |
|||
5TTS | Predicted |
e5ttsA1 |
|||
5TTU | Predicted |
e5ttuA1 |
|||
5TTV | Predicted |
e5ttvA1 |
|||
5VO6 | Predicted |
e5vo6A1 |
|||
5W86 | Predicted |
e5w86A1 e5w86C1 e5w86D1 e5w86B1 |
|||
5WFJ | Predicted |
e5wfjA1 |
|||
6AAK | Predicted |
e6aakB1 e6aakC1 e6aakD1 e6aakA1 |
|||
6DA4 | Predicted |
e6da4A1 |
|||
6DB3 | Predicted |
e6db3A1 |
|||
6DB4 | Predicted |
e6db4A1 |
|||
6DUD | Predicted |
e6dudA1 |
|||
6GL9 | Predicted |
e6gl9A1 e6gl9B1 |
|||
6GLA | Predicted |
e6glaA1 e6glaB1 |
|||
6GLB | Predicted |
e6glbA1 e6glbB1 |
|||
6HZV | Predicted |
e6hzvB1 e6hzvA1 e6hzvC1 e6hzvD1 |
|||
6NY4 | Predicted |
e6ny4A1 |