DB15035 Zanubrutinib
InChI Key: RNOAOAWBMHREKO-QFIPXVFZSA-N
SMILES: NC(=O)C1=C2NCC[C@@H](C3CCN(CC3)C(=O)C=C)N2N=C1C1=CC=C(OC2=CC=CC=C2)C=C1
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P52333
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P52333 | Download | Predicted | P52333_nD6 P52333_nD5 | Protein kinase/SAICAR synthase/ATP-grasp Protein kinase/SAICAR synthase/ATP-grasp | |
1YVJ | Predicted | e1yvjA1 | |||
3LXK | Predicted | e3lxkA1 | |||
3LXL | Predicted | e3lxlA1 | |||
3PJC | Predicted | e3pjcA1 | |||
3ZC6 | Predicted | e3zc6C1 e3zc6A1 e3zc6B1 e3zc6D1 | |||
3ZEP | Predicted | e3zepD1 e3zepA1 e3zepB1 e3zepC1 | |||
4HVD | Predicted | e4hvdA1 | |||
4HVG | Predicted | e4hvgA1 | |||
4HVH | Predicted | e4hvhA1 | |||
4HVI | Predicted | e4hviA1 | |||
4I6Q | Predicted | e4i6qA1 | |||
4QPS | Predicted | e4qpsC1 e4qpsA1 | |||
4QT1 | Predicted | e4qt1A1 | |||
4RIO | Predicted | e4rioA1 | |||
4V0G | Predicted | e4v0gA1 e4v0gB1 | |||
4Z16 | Predicted | e4z16A1 e4z16B1 e4z16C1 e4z16D1 | |||
5LWM | Predicted | e5lwmA1 | |||
5LWN | Predicted | e5lwnA1 | |||
5TOZ | Predicted | e5tozA1 | |||
5TTS | Predicted | e5ttsA1 | |||
5TTU | Predicted | e5ttuA1 | |||
5TTV | Predicted | e5ttvA1 | |||
5VO6 | Predicted | e5vo6A1 | |||
5W86 | Predicted | e5w86A1 e5w86C1 e5w86D1 e5w86B1 | |||
5WFJ | Predicted | e5wfjA1 | |||
6AAK | Predicted | e6aakB1 e6aakC1 e6aakD1 e6aakA1 | |||
6DA4 | Predicted | e6da4A1 | |||
6DB3 | Predicted | e6db3A1 | |||
6DB4 | Predicted | e6db4A1 | |||
6DUD | Predicted | e6dudA1 | |||
6GL9 | Predicted | e6gl9A1 e6gl9B1 | |||
6GLA | Predicted | e6glaA1 e6glaB1 | |||
6GLB | Predicted | e6glbA1 e6glbB1 | |||
6HZV | Predicted | e6hzvB1 e6hzvA1 e6hzvC1 e6hzvD1 | |||
6NY4 | Predicted | e6ny4A1 |