DB00171 ATP
InChI Key: ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES: NC1=NC=NC2=C1N=CN2[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
Small molecule PDB accession : ATP
Drug action: n/a
List of drug binding-associated PTMs
List of PDB structures and/or AlphaFold models with target protein P53041
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P53041 | Download | Predicted | P53041_nD1 | Repetitive alpha hairpins | |
| 1A17 | Predicted | e1a17A1 | |||
| 1S95 | Predicted | e1s95A1 e1s95B1 | |||
| 1WAO | Predicted | e1wao11 e1wao21 e1wao31 e1wao41 e1wao12 e1wao32 e1wao22 e1wao42 | |||
| 2BUG | Predicted | e2bugA1 | |||
| 3H60 | Predicted | e3h60A1 e3h60B1 | |||
| 3H61 | Predicted | e3h61A1 e3h61D1 | |||
| 3H62 | Predicted | e3h62C1 e3h62B1 | |||
| 3H63 | Predicted | e3h63A1 e3h63C1 | |||
| 3H64 | Predicted | e3h64A1 e3h64D1 | |||
| 3H66 | Predicted | e3h66A1 e3h66B1 | |||
| 3H67 | Predicted | e3h67A1 e3h67D1 | |||
| 3H68 | Predicted | e3h68A1 e3h68D1 | |||
| 3H69 | Predicted | e3h69A1 e3h69D1 | |||
| 4ZVZ | Predicted | e4zvzA1 e4zvzB1 e4zvzC1 e4zvzD1 | |||
| 4ZX2 | Predicted | e4zx2A1 | |||
| 5HPE | Predicted | e5hpeA1 | |||
| 5UI1 | Predicted | e5ui1C1 e5ui1A1 e5ui1B1 e5ui1D1 | |||
| 5WG8 | Predicted | e5wg8A1 |