DB11973 Tesevatinib
InChI Key: HVXKQKFEHMGHSL-QKDCVEJESA-N
SMILES: COC1=C(OC[C@H]2C[C@H]3CN(C)C[C@H]3C2)C=C2N=CN=C(NC3=CC=C(Cl)C(Cl)=C3F)C2=C1
Small molecule PDB accession : n/a
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P54760
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P54760 | Download | Predicted | P54760_nD8 P54760_nD7 P54760_nD1 | HhH/H2TH Protein kinase/SAICAR synthase/ATP-grasp jelly-roll | |
2BBA | Predicted | e2bbaA1 | |||
2E7H | Predicted | e2e7hA1 | |||
2QKQ | Predicted | e2qkqA1 e2qkqB1 | |||
2VWU | Predicted | e2vwuA1 | |||
2VWV | Predicted | e2vwvA1 | |||
2VWW | Predicted | e2vwwA1 | |||
2VWX | Predicted | e2vwxA1 | |||
2VWY | Predicted | e2vwyA1 | |||
2VWZ | Predicted | e2vwzA1 | |||
2VX0 | Predicted | e2vx0A1 | |||
2VX1 | Predicted | e2vx1A1 | |||
2X9F | Predicted | e2x9fA1 | |||
2XVD | Predicted | e2xvdA1 | |||
2YN8 | Predicted | e2yn8A1 e2yn8B1 | |||
3ZEW | Predicted | e3zewA1 e3zewB1 | |||
4AW5 | Predicted | e4aw5A1 | |||
4BB4 | Predicted | e4bb4A1 | |||
6FNI | Predicted | e6fniA1 | |||
6FNJ | Predicted | e6fnjA1 e6fnjB1 | |||
6FNK | Predicted | e6fnkA1 | |||
6FNL | Predicted | e6fnlA1 | |||
6FNM | Predicted | e6fnmA1 |