DB13174 Rhein
InChI Key: FCDLCPWAQCPTKC-UHFFFAOYSA-N
SMILES: OC(=O)C1=CC2=C(C(O)=C1)C(=O)C1=C(C=CC=C1O)C2=O
Small molecule PDB accession : RHN
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P55055
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P55055 | Download | Predicted | P55055_nD1 P55055_nD2 | Glucocorticoid receptor-like Nuclear receptor ligand-binding domain | |
| 1P8D | Predicted | e1p8dB1 e1p8dA1 | |||
| 1PQ6 | Predicted | e1pq6B1 e1pq6A1 e1pq6C1 e1pq6D1 | |||
| 1PQ9 | Predicted | e1pq9A1 e1pq9D1 e1pq9C1 e1pq9B1 | |||
| 1PQC | Predicted | e1pqcA1 e1pqcD1 e1pqcC1 e1pqcB1 | |||
| 1UPV | Predicted | e1upvA1 | |||
| 1UPW | Predicted | e1upwA1 | |||
| 3KFC | Predicted | e3kfcA1 e3kfcD1 e3kfcB1 e3kfcC1 | |||
| 3L0E | Predicted | e3l0eA1 | |||
| 4DK7 | Predicted | e4dk7A1 e4dk7C1 | |||
| 4DK8 | Predicted | e4dk8A1 e4dk8C1 | |||
| 4RAK | Predicted | e4rakA1 e4rakB1 | |||
| 5HJP | Predicted | e5hjpB1 e5hjpD1 | |||
| 5JY3 | Predicted | e5jy3A1 e5jy3B1 e5jy3C1 e5jy3D1 | |||
| 5KYA | Predicted | e5kyaA1 e5kyaE1 | |||
| 5KYJ | Predicted | e5kyjA1 e5kyjE1 | |||
| 6JIO | Predicted | e6jioA1 e6jioD1 e6jioB1 e6jioC1 | |||
| 6S4N | Predicted | e6s4nD1 e6s4nA1 e6s4nB1 e6s4nC1 | |||
| 6S4T | Predicted | e6s4tA1 | |||
| 6S4U | Predicted | e6s4uC1 e6s4uA1 e6s4uB1 | |||
| 6S5K | Predicted | e6s5kA1 |