DB07374 Anisomycin
InChI Key: YKJYKKNCCRKFSL-RDBSUJKOSA-N
SMILES: [H][C@]1(O)CN[C@]([H])(CC2=CC=C(OC)C=C2)[C@]1([H])OC(C)=O
Small molecule PDB accession : ANM
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P55769
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P55769 | Download | Predicted | P55769_nD1 | Bacillus chorismate mutase-like | |
| 1E7K | Predicted | e1e7kA1 e1e7kB1 | |||
| 2JNB | Predicted | e2jnbA1 | |||
| 2OZB | Predicted | e2ozbA1 e2ozbD1 | |||
| 3JCR | Predicted | e3jcrI2 | |||
| 3SIU | Predicted | e3siuA1 e3siuD1 | |||
| 3SIV | Predicted | e3sivA1 e3sivD1 e3sivG1 e3sivJ1 | |||
| 5O9Z | Predicted | e5o9zO1 | |||
| 6AH0 | Predicted | e6ah0M1 | |||
| 6AHD | Predicted | e6ahdM1 | |||
| 6QW6 | Predicted | e6qw64D1 | |||
| 6QX9 | Predicted | e6qx94D1 |