DB11638 Artenimol
InChI Key: BJDCWCLMFKKGEE-HVDUHBCDSA-N
SMILES: [H][C@@]1(C)CC[C@@]2([H])[C@@]([H])(C)C([H])(O)O[C@]3([H])O[C@@]4(C)CC[C@]1([H])[C@@]23OO4
Small molecule PDB accession : n/a
Drug action: ligand
List of PDB structures and/or AlphaFold models with target protein P60174
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P60174 | Download | Predicted | P60174_nD1 | TIM beta/alpha-barrel | |
| 1HTI | Predicted | e1htiA1 e1htiB1 | |||
| 1WYI | Predicted | e1wyiA1 e1wyiB1 | |||
| 2JK2 | Predicted | e2jk2B1 e2jk2A1 | |||
| 2VOM | Predicted | e2vomA1 e2vomB1 e2vomC1 e2vomD1 | |||
| 4BR1 | Predicted | e4br1B1 e4br1A1 | |||
| 4POC | Predicted | e4pocB1 e4pocA1 | |||
| 4POD | Predicted | e4podA1 e4podB1 | |||
| 4UNK | Predicted | e4unkB1 e4unkA1 | |||
| 4UNL | Predicted | e4unlA1 e4unlB1 | |||
| 4ZVJ | Predicted | e4zvjA1 e4zvjB1 | |||
| 6C2G | Predicted | e6c2gA1 e6c2gB1 e6c2gC1 e6c2gD1 | |||
| 6D43 | Predicted | e6d43B1 e6d43A1 | |||
| 6NLH | Predicted | e6nlhB1 e6nlhA1 e6nlhE1 e6nlhC1 e6nlhD1 e6nlhF1 e6nlhG1 e6nlhH1 |