DB01327 Cefazolin
InChI Key: MLYYVTUWGNIJIB-BXKDBHETSA-N
SMILES: [H][C@]12SCC(CSC3=NN=C(C)S3)=C(N1C(=O)[C@H]2NC(=O)CN1C=NN=N1)C(O)=O
Small molecule PDB accession : n/a
Drug action: inhibitor
List of PDB structures and/or AlphaFold models with target protein P60568
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P60568 | Download | Predicted | P60568_nD1 | Ferritin/Heme oxygenase/4-helical cytokines | |
| 1IRL | Predicted | e1irlA1 | |||
| 1M47 | Predicted | e1m47A1 | |||
| 1M48 | Predicted | e1m48A1 e1m48B1 | |||
| 1M49 | Predicted | e1m49A1 e1m49B1 | |||
| 1M4A | Predicted | e1m4aA1 | |||
| 1M4B | Predicted | e1m4bA1 | |||
| 1M4C | Predicted | e1m4cA1 e1m4cB1 | |||
| 1NBP | Predicted | e1nbpA1 | |||
| 1PW6 | Predicted | e1pw6A1 e1pw6B1 | |||
| 1PY2 | Predicted | e1py2B1 e1py2D1 e1py2A1 e1py2C1 | |||
| 1QVN | Predicted | e1qvnB1 e1qvnC1 e1qvnA1 e1qvnD1 | |||
| 1Z92 | Predicted | e1z92A1 | |||
| 2B5I | Predicted | e2b5iA1 | |||
| 2ERJ | Predicted | e2erjD1 e2erjH1 | |||
| 3INK | Predicted | e3inkD1 e3inkC1 | |||
| 3QAZ | Predicted | e3qazA1 e3qazS1 e3qazh1 e3qazP1 e3qazM1 e3qaze1 e3qazJ1 e3qazD1 e3qazV1 e3qazb1 e3qazG1 e3qazY1 | |||
| 3QB1 | Predicted | e3qb1F1 e3qb1A1 e3qb1B1 e3qb1H2 e3qb1C2 e3qb1E2 e3qb1G2 e3qb1D2 | |||
| 4NEJ | Predicted | e4nejA1 | |||
| 4NEM | Predicted | e4nemA1 | |||
| 5LQB | Predicted | e5lqbA1 | |||
| 5M5E | Predicted | e5m5eD1 | |||
| 5UTZ | Predicted | e5utzA1 e5utzE1 e5utzD1 e5utzI1 |