DB08437 Puromycin
InChI Key: RXWNCPJZOCPEPQ-NVWDDTSBSA-N
SMILES: COC1=CC=C(C[C@H](N)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1
Small molecule PDB accession : PUY
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P61313
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P61313 | Download | Predicted | P61313_nD1 | Alpha-beta plaits | |
4UG0 | Predicted | e4ug0LN1 | |||
4V6X | Predicted | e4v6xCN1 | |||
5AJ0 | Predicted | e5aj0AN1 | |||
5LKS | Predicted | e5lksLN1 | |||
5T2C | Predicted | e5t2ct1 | |||
6IP5 | Predicted | e6ip52H1 | |||
6IP6 | Predicted | e6ip62H1 | |||
6IP8 | Predicted | e6ip82H1 | |||
6OLE | Predicted | e6oleO1 | |||
6OLF | Predicted | e6olfO1 | |||
6OLG | Predicted | e6olgAN1 | |||
6OLI | Predicted | e6oliO1 | |||
6OLZ | Predicted | e6olzAN1 | |||
6OM0 | Predicted | e6om0O1 | |||
6OM7 | Predicted | e6om7O1 | |||
6QZP | Predicted | e6qzpLN1 |