DB08437 Puromycin
InChI Key: RXWNCPJZOCPEPQ-NVWDDTSBSA-N
SMILES: COC1=CC=C(C[C@H](N)C(=O)N[C@@H]2[C@@H](CO)O[C@H]([C@@H]2O)N2C=NC3=C2N=CN=C3N(C)C)C=C1
Small molecule PDB accession : PUY
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P62829
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P62829 | Download | Predicted | P62829_nD1 | Ribosomal protein L14-like | |
4UG0 | Predicted | e4ug0LV1 | |||
4V6X | Predicted | e4v6xCV1 | |||
5AJ0 | Predicted | e5aj0AV1 | |||
5LKS | Predicted | e5lksLV1 | |||
5T2C | Predicted | e5t2cP1 | |||
6IP5 | Predicted | e6ip52P1 | |||
6IP6 | Predicted | e6ip62P1 | |||
6IP8 | Predicted | e6ip82P1 | |||
6OLE | Predicted | e6oleW1 | |||
6OLF | Predicted | e6olfW1 | |||
6OLG | Predicted | e6olgAV1 | |||
6OLI | Predicted | e6oliW1 | |||
6OLZ | Predicted | e6olzAV1 | |||
6OM0 | Predicted | e6om0W1 | |||
6OM7 | Predicted | e6om7W1 | |||
6QZP | Predicted | e6qzpLV1 |