DB07374 Anisomycin
InChI Key: YKJYKKNCCRKFSL-RDBSUJKOSA-N
SMILES: [H][C@]1(O)CN[C@]([H])(CC2=CC=C(OC)C=C2)[C@]1([H])OC(C)=O
Small molecule PDB accession : ANM
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P62913
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P62913 | Download | Predicted | P62913_nD1 | Ribosomal protein L5 | |
4UG0 | Predicted | e4ug0LJ1 | |||
4V6X | Predicted | e4v6xCJ1 | |||
4XXB | Predicted | e4xxbA1 | |||
5AJ0 | Predicted | e5aj0AJ1 | |||
5LKS | Predicted | e5lksLJ1 | |||
5T2C | Predicted | e5t2cq1 | |||
6IP5 | Predicted | e6ip52E1 | |||
6IP6 | Predicted | e6ip62E1 | |||
6IP8 | Predicted | e6ip82E1 | |||
6OLE | Predicted | e6oleL1 | |||
6OLF | Predicted | e6olfL1 | |||
6OLG | Predicted | e6olgAJ1 | |||
6OLI | Predicted | e6oliL1 | |||
6OLZ | Predicted | e6olzAJ1 | |||
6OM0 | Predicted | e6om0L1 | |||
6OM7 | Predicted | e6om7L1 | |||
6QZP | Predicted | e6qzpLJ1 |