DB01244 Bepridil
InChI Key: UIEATEWHFDRYRU-UHFFFAOYSA-N
SMILES: CC(C)COCC(CN(CC1=CC=CC=C1)C1=CC=CC=C1)N1CCCC1
Small molecule PDB accession : n/a
Drug action: other
List of PDB structures and/or AlphaFold models with target protein P63316
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P63316 | Download | Predicted | P63316_nD2 P63316_nD1 | EF-hand EF-hand | |
1AP4 | Predicted | e1ap4A1 | |||
1IH0 | Predicted | e1ih0A1 | |||
1J1D | Predicted | e1j1dA2 e1j1dD2 e1j1dA1 e1j1dD1 | |||
1J1E | Predicted | e1j1eA2 e1j1eD2 e1j1eA1 e1j1eD1 | |||
1LXF | Predicted | e1lxfC1 | |||
1MXL | Predicted | e1mxlC1 | |||
1OZS | Predicted | e1ozsA1 | |||
1SPY | Predicted | e1spyA1 | |||
1WRK | Predicted | e1wrkB1 e1wrkA1 | |||
1WRL | Predicted | e1wrlF1 e1wrlD1 e1wrlA1 e1wrlB1 e1wrlC1 e1wrlE1 | |||
2JT0 | Predicted | e2jt0A2 e2jt0A1 | |||
2JT3 | Predicted | e2jt3A2 e2jt3A1 | |||
2JT8 | Predicted | e2jt8A3 e2jt8A4 | |||
2JTZ | Predicted | e2jtzA2 e2jtzA1 | |||
2JXL | Predicted | e2jxlA1 | |||
2KDH | Predicted | e2kdhA1 | |||
2KFX | Predicted | e2kfxT1 | |||
2KGB | Predicted | e2kgbC1 | |||
2KRD | Predicted | e2krdC1 | |||
2L1R | Predicted | e2l1rA1 | |||
2L98 | Predicted | e2l98A1 | |||
2MKP | Predicted | e2mkpC1 | |||
2MLE | Predicted | e2mleC1 | |||
2MLF | Predicted | e2mlfC1 | |||
2MZP | Predicted | e2mzpC1 | |||
2N79 | Predicted | e2n79C1 | |||
2N7L | Predicted | e2n7lC1 | |||
3RV5 | Predicted | e3rv5A1 e3rv5C1 e3rv5B1 e3rv5D1 | |||
3SD6 | Predicted | e3sd6A1 | |||
3SWB | Predicted | e3swbA1 | |||
4GJE | Predicted | e4gjeA1 | |||
4GJF | Predicted | e4gjfA2 | |||
4GJG | Predicted | e4gjgA2 | |||
4Y99 | Predicted | e4y99A1 e4y99A2 | |||
5VLN | Predicted | e5vlnA1 | |||
5W88 | Predicted | e5w88A1 | |||
5WCL | Predicted | e5wclA1 | |||
6MV3 | Predicted | e6mv3A1 |