DB00163 Vitamin E
InChI Key: GVJHHUAWPYXKBD-IEOSBIPESA-N
SMILES: CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(O1)C(C)=C(C)C(O)=C2C
Small molecule PDB accession : VIV
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P67775
PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
---|---|---|---|---|---|
P67775 | Download | Predicted | P67775_nD1 | Carbon-nitrogen hydrolase-like | |
2IAE | Predicted | e2iaeF1 e2iaeC1 | |||
2IE3 | Predicted | e2ie3C1 | |||
2IE4 | Predicted | e2ie4C1 | |||
2NPP | Predicted | e2nppF1 e2nppC1 | |||
2NYL | Predicted | e2nylC1 e2nylF1 | |||
2NYM | Predicted | e2nymF1 e2nymC1 | |||
3C5W | Predicted | e3c5wC1 | |||
3DW8 | Predicted | e3dw8C1 e3dw8F1 | |||
3FGA | Predicted | e3fgaC1 | |||
3K7V | Predicted | e3k7vC1 | |||
3K7W | Predicted | e3k7wC1 | |||
3P71 | Predicted | e3p71C1 | |||
4I5L | Predicted | e4i5lC1 e4i5lF2 | |||
4I5N | Predicted | e4i5nC2 e4i5nF2 | |||
4IYP | Predicted | e4iypC1 | |||
4LAC | Predicted | e4lacC1 | |||
5W0W | Predicted | e5w0wC1 e5w0wF1 e5w0wI1 e5w0wL1 |