DB04216 Quercetin
InChI Key: REFJWTPEDVJJIY-UHFFFAOYSA-N
SMILES: OC1=CC2=C(C(O)=C1)C(=O)C(O)=C(O2)C1=CC=C(O)C(O)=C1
Small molecule PDB accession : QUE
Drug action: n/a
List of PDB structures and/or AlphaFold models with target protein P67870
| PDB/AF Accession | PyMOL script | Experimental / Predicted | Interacting ECOD domains | ECOD X-group name | LigPlot |
|---|---|---|---|---|---|
| P67870 | Download | Predicted | P67870_nD1 | Rubredoxin-like | |
| 1JWH | Predicted | e1jwhC1 e1jwhD1 | |||
| 1QF8 | Predicted | e1qf8A1 e1qf8B1 | |||
| 3EED | Predicted | e3eedB1 e3eedA1 | |||
| 4DGL | Predicted | e4dglA1 e4dglB1 | |||
| 4MD7 | Predicted | e4md7A1 e4md7B1 e4md7C1 e4md7D1 | |||
| 4MD8 | Predicted | e4md8A1 e4md8B1 e4md8C1 e4md8D1 | |||
| 4MD9 | Predicted | e4md9A1 e4md9B1 e4md9C1 e4md9D1 e4md9I1 e4md9J1 e4md9N1 e4md9O1 | |||
| 4NH1 | Predicted | e4nh1C1 e4nh1D1 |